What is the PubChem CID for Triisopentylamine?
PubChem CID 69525.
What is the molecular formula of Triisopentylamine?
The molecular formula is C15H33N.
What are the synonyms for Triisopentylamine?
The synonyms are Triisoamylamine, 645-41-0, Tris(3-methylbutyl)amine, and 1-Butanamine, 3-methyl-N,N-bis(3-methylbutyl)-.
What is the molecular weight of Triisopentylamine?
The molecular weight is 227.43 g/mol.
What is the IUPAC name of Triisopentylamine?
The IUPAC name is 3-methyl-N,N-bis(3-methylbutyl)butan-1-amine.
What is the InChI of Triisopentylamine?
The InChI is InChI=1S/C15H33N/c1-13(2)7-10-16(11-8-14(3)4)12-9-15(5)6/h13-15H,7-12H2,1-6H3.
What is the InChIKey of Triisopentylamine?
The InChIKey is QKVUSSUOYHTOFQ-UHFFFAOYSA-N.
What is the canonical SMILES of Triisopentylamine?
The canonical SMILES is CC(C)CCN(CCC(C)C)CCC(C)C.
What is the CAS number of Triisopentylamine?
The CAS number is 645-41-0.
How many hydrogen bond donor counts does Triisopentylamine have?
Triisopentylamine has 0 hydrogen bond donor count.