What is the molecular formula of Trifluorothymine?
The molecular formula of Trifluorothymine is C5H3F3N2O2.
When was Trifluorothymine created and modified?
Trifluorothymine was created on March 26, 2005, and last modified on December 30, 2023.
What is the IUPAC name of Trifluorothymine?
The IUPAC name of Trifluorothymine is 5-(trifluoromethyl)-1H-pyrimidine-2,4-dione.
What is the InChI of Trifluorothymine?
The InChI of Trifluorothymine is InChI=1S/C5H3F3N2O2/c6-5(7,8)2-1-9-4(12)10-3(2)11/h1H,(H2,9,10,11,12).
What is the InChIKey of Trifluorothymine?
The InChIKey of Trifluorothymine is LMNPKIOZMGYQIU-UHFFFAOYSA-N.
What is the Canonical SMILES of Trifluorothymine?
The Canonical SMILES of Trifluorothymine is C1=C(C(=O)NC(=O)N1)C(F)(F)F.
What is the CAS number of Trifluorothymine?
The CAS number of Trifluorothymine is 54-20-6.
What is the molecular weight of Trifluorothymine?
The molecular weight of Trifluorothymine is 180.08 g/mol.
How many hydrogen bond donor counts does Trifluorothymine have?
Trifluorothymine has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Trifluorothymine have?
Trifluorothymine has 5 hydrogen bond acceptor counts.