What is the molecular formula of 3-Pyridyltriethoxysilane?
The molecular formula of 3-Pyridyltriethoxysilane is C11H19NO3Si.
What are the synonyms for 3-Pyridyltriethoxysilane?
The synonyms for 3-Pyridyltriethoxysilane are Pyridine, 3-(triethoxysilyl)-, triethoxy(pyridin-3-yl)silane, and 3-(triethoxysilyl)pyridine.
What is the molecular weight of 3-Pyridyltriethoxysilane?
The molecular weight of 3-Pyridyltriethoxysilane is 241.36 g/mol.
When was 3-Pyridyltriethoxysilane created?
3-Pyridyltriethoxysilane was created on October 26, 2006.
What is the IUPAC name of 3-Pyridyltriethoxysilane?
The IUPAC name of 3-Pyridyltriethoxysilane is triethoxy(pyridin-3-yl)silane.
What is the InChI of 3-Pyridyltriethoxysilane?
The InChI of 3-Pyridyltriethoxysilane is InChI=1S/C11H19NO3Si/c1-4-13-16(14-5-2,15-6-3)11-8-7-9-12-10-11/h7-10H,4-6H2,1-3H3.
What is the InChIKey of 3-Pyridyltriethoxysilane?
The InChIKey of 3-Pyridyltriethoxysilane is DDBKHNYWLUTKDZ-UHFFFAOYSA-N.
What is the canonical SMILES representation of 3-Pyridyltriethoxysilane?
The canonical SMILES representation of 3-Pyridyltriethoxysilane is CCO[Si](C1=CN=CC=C1)(OCC)OCC.
What is the CAS number of 3-Pyridyltriethoxysilane?
The CAS number of 3-Pyridyltriethoxysilane is 129663-08-7.
What is the exact mass of 3-Pyridyltriethoxysilane?
The exact mass of 3-Pyridyltriethoxysilane is 241.11342000 g/mol.