What is the molecular formula of triamcinolone diacetate?
The molecular formula of triamcinolone diacetate is C25H31FO8.
What is the molecular weight of triamcinolone diacetate?
The molecular weight of triamcinolone diacetate is 478.5 g/mol.
What is the IUPAC name of triamcinolone diacetate?
The IUPAC name of triamcinolone diacetate is [2-[(8S,9R,10S,11S,13S,14S,16R,17S)-16-acetyloxy-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
What is the InChI of triamcinolone diacetate?
The InChI of triamcinolone diacetate is InChI=1S/C25H31FO8/c1-13(27)33-12-20(31)25(32)21(34-14(2)28)10-18-17-6-5-15-9-16(29)7-8-22(15,3)24(17,26)19(30)11-23(18,25)4/h7-9,17-19,21,30,32H,5-6,10-12H2,1-4H3/t17-,18-,19-,21+,22-,23-,24-,25+/m0/s1.
What is the InChIKey of triamcinolone diacetate?
The InChIKey of triamcinolone diacetate is XGMPVBXKDAHORN-RBWIMXSLSA-N.
What is the Canonical SMILES of triamcinolone diacetate?
The Canonical SMILES of triamcinolone diacetate is CC(=O)OCC(=O)C1(C(CC2C1(CC(C3(C2CCC4=CC(=O)C=CC43C)F)O)C)OC(=O)C)O.
What is the CAS number of triamcinolone diacetate?
The CAS number of triamcinolone diacetate is 67-78-7.
What is the European Community (EC) Number of triamcinolone diacetate?
The European Community (EC) Number of triamcinolone diacetate is 200-669-0.
What is the UNII of triamcinolone diacetate?
The UNII of triamcinolone diacetate is A73MM2Q32P.
What is the ChEMBL ID of triamcinolone diacetate?
The ChEMBL ID of triamcinolone diacetate is CHEMBL1200449.