What is the PubChem CID of Tri-i-propylphosphonium tetrafluoroborate?
PubChem CID is 11107681.
What is the molecular formula of Tri-i-propylphosphonium tetrafluoroborate?
The molecular formula is C9H22BF4P.
What is the molecular weight of Tri-i-propylphosphonium tetrafluoroborate?
The molecular weight is 248.05 g/mol.
What are the synonyms for Tri-i-propylphosphonium tetrafluoroborate?
The synonyms are TRIISOPROPYLPHOSPHONIUM TETRAFLUOROBORATE, 121099-07-8, tri(propan-2-yl)phosphanium;tetrafluoroborate, Tris(1-methylethyl)phosphine tetrafluoroborate.
When was Tri-i-propylphosphonium tetrafluoroborate created and modified in PubChem?
It was created on October 26, 2006, and last modified on December 2, 2023.
What is the IUPAC name of Tri-i-propylphosphonium tetrafluoroborate?
The IUPAC name is tri(propan-2-yl)phosphanium;tetrafluoroborate.
What is the InChI of Tri-i-propylphosphonium tetrafluoroborate?
The InChI is InChI=1S/C9H21P.BF4/c1-7(2)10(8(3)4)9(5)6;2-1(3,4)5/h7-9H,1-6H3;/q;-1/p+1.
What is the InChIKey of Tri-i-propylphosphonium tetrafluoroborate?
The InChIKey is KGBIZABAOCDZNU-UHFFFAOYSA-O.
What is the canonical SMILES of Tri-i-propylphosphonium tetrafluoroborate?
The canonical SMILES is [B-](F)(F)(F)F.CC(C)[PH+](C(C)C)C(C)C.
What is the CAS number of Tri-i-propylphosphonium tetrafluoroborate?
The CAS number is 121099-07-8.
※ Please kindly note that our products are for research use only.