What is the molecular formula of trans-Beta-nitrostyrene?
The molecular formula of trans-Beta-nitrostyrene is C8H7NO2.
What is the molecular weight of trans-Beta-nitrostyrene?
The molecular weight of trans-Beta-nitrostyrene is 149.15 g/mol.
What are the synonyms of trans-Beta-nitrostyrene?
The synonyms of trans-Beta-nitrostyrene are trans-beta-Nitrostyrene, 5153-67-3, (2-Nitrovinyl)benzene, and (E)-(2-Nitrovinyl)benzene.
What is the IUPAC Name of trans-Beta-nitrostyrene?
The IUPAC name of trans-Beta-nitrostyrene is [(E)-2-nitroethenyl]benzene.
What is the InChI of trans-Beta-nitrostyrene?
The InChI of trans-Beta-nitrostyrene is InChI=1S/C8H7NO2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H/b7-6+.
What is the InChIKey of trans-Beta-nitrostyrene?
The InChIKey of trans-Beta-nitrostyrene is PIAOLBVUVDXHHL-VOTSOKGWSA-N.
What is the canonical SMILES of trans-Beta-nitrostyrene?
The canonical SMILES of trans-Beta-nitrostyrene is C1=CC=C(C=C1)C=C[N+](=O)[O-].
What is the isomeric SMILES of trans-Beta-nitrostyrene?
The isomeric SMILES of trans-Beta-nitrostyrene is C1=CC=C(C=C1)/C=C/[N+](=O)[O-].
What is the CAS number of trans-Beta-nitrostyrene?
The CAS number of trans-Beta-nitrostyrene is 102-96-5.