What is the molecular formula of trans-4-Methylcyclohexylamine?
The molecular formula is C7H15N.
What is the molecular weight of trans-4-Methylcyclohexylamine?
The molecular weight is 113.20 g/mol.
What are the synonyms of trans-4-Methylcyclohexylamine?
The synonyms are 4-Methylcyclohexylamine, Trans-4-Methylcyclohexylamine, 2523-55-9, 6321-23-9, 4-Methylcyclohexanamine.
What are the safety precautions associated with trans-4-Methylcyclohexylamine?
Contact with the skin, eyes, and mucous membranes can cause severe chemical burns. It is toxic through skin absorption, and exposure to fire can release toxic ammonia and nitrogen oxides.
What is the IUPAC name of trans-4-Methylcyclohexylamine?
The IUPAC name is 4-methylcyclohexan-1-amine.
What is the InChI of trans-4-Methylcyclohexylamine?
The InChI is InChI=1S/C7H15N/c1-6-2-4-7(8)5-3-6/h6-7H,2-5,8H2,1H3.
What is the Canonical SMILES of trans-4-Methylcyclohexylamine?
The Canonical SMILES is CC1CCC(CC1)N.
What is the CAS number of trans-4-Methylcyclohexylamine?
The CAS number is 2523-56-0.
What is the UN number of trans-4-Methylcyclohexylamine?
The UN number is 1760.
※ Please kindly note that our products are for research use only.