What is the molecular formula of Thiazol-5-ylboronic acid?
The molecular formula of Thiazol-5-ylboronic acid is C3H4BNO2S.
What is the molecular weight of Thiazol-5-ylboronic acid?
The molecular weight of Thiazol-5-ylboronic acid is 128.95 g/mol.
What is the IUPAC name of Thiazol-5-ylboronic acid?
The IUPAC name of Thiazol-5-ylboronic acid is 1,3-thiazol-5-ylboronic acid.
What is the InChI of Thiazol-5-ylboronic acid?
The InChI of Thiazol-5-ylboronic acid is "InChI=1S/C3H4BNO2S/c6-4(7)3-1-5-2-8-3/h1-2,6-7H".
What is the InChIKey of Thiazol-5-ylboronic acid?
The InChIKey of Thiazol-5-ylboronic acid is "OPMGYPOENUJLEM-UHFFFAOYSA-N".
What is the canonical SMILES of Thiazol-5-ylboronic acid?
The canonical SMILES of Thiazol-5-ylboronic acid is "B(C1=CN=CS1)(O)O".
What is the CAS number of Thiazol-5-ylboronic acid?
The CAS number of Thiazol-5-ylboronic acid is 942190-81-0.
What is the European Community (EC) number of Thiazol-5-ylboronic acid?
The European Community (EC) number of Thiazol-5-ylboronic acid is 810-096-3.
How many hydrogen bond donor counts does Thiazol-5-ylboronic acid have?
Thiazol-5-ylboronic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Thiazol-5-ylboronic acid have?
Thiazol-5-ylboronic acid has 4 hydrogen bond acceptor counts.