What is the molecular formula of thiazol-2-ylboronic acid?
The molecular formula of thiazol-2-ylboronic acid is C3H4BNO2S.
What is the molecular weight of thiazol-2-ylboronic acid?
The molecular weight of thiazol-2-ylboronic acid is 128.95 g/mol.
What is the IUPAC name of thiazol-2-ylboronic acid?
The IUPAC name of thiazol-2-ylboronic acid is 1,3-thiazol-2-ylboronic acid.
What is the InChI of thiazol-2-ylboronic acid?
The InChI of thiazol-2-ylboronic acid is InChI=1S/C3H4BNO2S/c6-4(7)3-5-1-2-8-3/h1-2,6-7H.
What is the InChIKey of thiazol-2-ylboronic acid?
The InChIKey of thiazol-2-ylboronic acid is JWUGKJKBCKJFOU-UHFFFAOYSA-N.
What is the canonical SMILES of thiazol-2-ylboronic acid?
The canonical SMILES of thiazol-2-ylboronic acid is B(C1=NC=CS1)(O)O.
What is the CAS number of thiazol-2-ylboronic acid?
The CAS number of thiazol-2-ylboronic acid is 389630-95-9.
How many hydrogen bond donor counts does thiazol-2-ylboronic acid have?
Thiazol-2-ylboronic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does thiazol-2-ylboronic acid have?
Thiazol-2-ylboronic acid has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does thiazol-2-ylboronic acid have?
Thiazol-2-ylboronic acid has 1 rotatable bond count.