What is the molecular formula of tetrofosmin?
The molecular formula of tetrofosmin is C18H40O4P2.
What is the molecular weight of tetrofosmin?
The molecular weight of tetrofosmin is 382.5 g/mol.
What is the IUPAC name of tetrofosmin?
The IUPAC name of tetrofosmin is 2-[bis(2-ethoxyethyl)phosphanyl]ethyl-bis(2-ethoxyethyl)phosphane.
What is the InChI of tetrofosmin?
The InChI of tetrofosmin is InChI=1S/C18H40O4P2/c1-5-19-9-13-23(14-10-20-6-2)17-18-24(15-11-21-7-3)16-12-22-8-4/h5-18H2,1-4H3.
What is the InChIKey of tetrofosmin?
The InChIKey of tetrofosmin is QCWJONLQSHEGEJ-UHFFFAOYSA-N.
What are the synonyms of tetrofosmin?
The synonyms of tetrofosmin are 127502-06-1, UNII-3J0KPB596Q, 3J0KPB596Q, and ethylenebis[bis(2-ethoxyethyl)phosphine].
What is the CAS number of tetrofosmin?
The CAS number of tetrofosmin is 127502-06-1.
What is the boiling point of tetrofosmin?
The boiling point of tetrofosmin is 100ºC.
How many rotatable bond counts are there in tetrofosmin?
There are 19 rotatable bond counts in tetrofosmin.
Is tetrofosmin a radiopharmaceutical?
Yes, tetrofosmin is used in conjunction with technetium Tc-99m as a radiopharmaceutical.