What is the molecular formula of Tetrapropoxysilane?
The molecular formula of Tetrapropoxysilane is C12H28O4Si.
What is the molecular weight of Tetrapropoxysilane?
The molecular weight of Tetrapropoxysilane is 264.43 g/mol.
What is the IUPAC name of Tetrapropoxysilane?
The IUPAC name of Tetrapropoxysilane is tetrapropyl silicate.
What is the InChI of Tetrapropoxysilane?
The InChI of Tetrapropoxysilane is InChI=1S/C12H28O4Si/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4/h5-12H2,1-4H3.
What is the InChIKey of Tetrapropoxysilane?
The InChIKey of Tetrapropoxysilane is ZQZCOBSUOFHDEE-UHFFFAOYSA-N.
What is the canonical SMILES of Tetrapropoxysilane?
The canonical SMILES of Tetrapropoxysilane is CCCO[Si](OCCC)(OCCC)OCCC.
What is the CAS number of Tetrapropoxysilane?
The CAS number of Tetrapropoxysilane is 682-01-9.
What is the EC number of Tetrapropoxysilane?
The EC number of Tetrapropoxysilane is 211-659-0.
What is the ChEMBL ID of Tetrapropoxysilane?
The ChEMBL ID of Tetrapropoxysilane is CHEMBL3181871.
Is Tetrapropoxysilane a canonicalized compound?
Yes, Tetrapropoxysilane is a canonicalized compound.