What is the molecular formula of Tetrahydrouridine?
The molecular formula of Tetrahydrouridine is C9H16N2O6.
What is the molecular weight of Tetrahydrouridine?
The molecular weight of Tetrahydrouridine is 248.23 g/mol.
What is the mechanism of action of Tetrahydrouridine according to DrugBank?
Tetrahydrouridine increases the efficacy of the radiosensitizer cytochlor by inhibiting the enzyme deoxycytidine monophosphate deaminase.
What is the IUPAC name of Tetrahydrouridine?
The IUPAC name of Tetrahydrouridine is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-hydroxy-1,3-diazinan-2-one.
What is the InChIKey of Tetrahydrouridine?
The InChIKey of Tetrahydrouridine is UCKYOOZPSJFJIZ-XVKVHKPRSA-N.
What is the canonical SMILES notation for Tetrahydrouridine?
The canonical SMILES notation for Tetrahydrouridine is C1CN(C(=O)NC1O)C2C(C(C(O2)CO)O)O.
What is the CAS number for Tetrahydrouridine?
The CAS number for Tetrahydrouridine is 18771-50-1.
What is the hydrogen bond donor count of Tetrahydrouridine?
The hydrogen bond donor count of Tetrahydrouridine is 5.
What is the hydrogen bond acceptor count of Tetrahydrouridine?
The hydrogen bond acceptor count of Tetrahydrouridine is 6.
What is the topological polar surface area of Tetrahydrouridine?
The topological polar surface area of Tetrahydrouridine is 123 Ų.