What is the molecular formula of Tetrabutylammonium Hydrogen Sulfate?
The molecular formula of Tetrabutylammonium Hydrogen Sulfate is C16H37NO4S.
What is the molecular weight of Tetrabutylammonium Hydrogen Sulfate?
The molecular weight of Tetrabutylammonium Hydrogen Sulfate is 339.5 g/mol.
What is the IUPAC name of Tetrabutylammonium Hydrogen Sulfate?
The IUPAC name of Tetrabutylammonium Hydrogen Sulfate is hydrogen sulfate;tetrabutylazanium.
What is the InChI of Tetrabutylammonium Hydrogen Sulfate?
The InChI of Tetrabutylammonium Hydrogen Sulfate is InChI=1S/C16H36N.H2O4S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-5(2,3)4/h5-16H2,1-4H3;(H2,1,2,3,4)/q+1;/p-1.
What is the Canonical SMILES of Tetrabutylammonium Hydrogen Sulfate?
The Canonical SMILES of Tetrabutylammonium Hydrogen Sulfate is CCCC[N+](CCCC)(CCCC)CCCC.OS(=O)(=O)[O-].
What is the CAS number of Tetrabutylammonium Hydrogen Sulfate?
The CAS number of Tetrabutylammonium Hydrogen Sulfate is 32503-27-8.
How many hydrogen bond donor atoms are there in Tetrabutylammonium Hydrogen Sulfate?
There is 1 hydrogen bond donor atom in Tetrabutylammonium Hydrogen Sulfate.
How many hydrogen bond acceptor atoms are there in Tetrabutylammonium Hydrogen Sulfate?
There are 4 hydrogen bond acceptor atoms in Tetrabutylammonium Hydrogen Sulfate.
How many rotatable bonds are there in Tetrabutylammonium Hydrogen Sulfate?
There are 12 rotatable bonds in Tetrabutylammonium Hydrogen Sulfate.
※ Please kindly note that our products are for research use only.