What is the PubChem CID of tert-butyl N-(4-bromophenyl)carbamate?
PubChem CID 2773608.
What is the molecular formula of tert-butyl N-(4-bromophenyl)carbamate?
The molecular formula is C11H14BrNO2.
What are the synonyms for tert-butyl N-(4-bromophenyl)carbamate?
The synonyms are 131818-17-2, tert-Butyl (4-bromophenyl)carbamate, tert-butyl N-(4-bromophenyl)carbamate, N-(tert-Butoxycarbonyl)-4-bromoaniline, and tert-butyl 4-bromophenylcarbamate.
What is the molecular weight of tert-butyl N-(4-bromophenyl)carbamate?
The molecular weight is 272.14 g/mol.
What is the IUPAC name of tert-butyl N-(4-bromophenyl)carbamate?
The IUPAC name is tert-butyl N-(4-bromophenyl)carbamate.
What is the InChI of tert-butyl N-(4-bromophenyl)carbamate?
The InChI is InChI=1S/C11H14BrNO2/c1-11(2,3)15-10(14)13-9-6-4-8(12)5-7-9/h4-7H,1-3H3,(H,13,14).
What is the InChIKey of tert-butyl N-(4-bromophenyl)carbamate?
The InChIKey is VLGPDTPSKUUHKR-UHFFFAOYSA-N.
What is the canonical SMILES of tert-butyl N-(4-bromophenyl)carbamate?
The canonical SMILES is CC(C)(C)OC(=O)NC1=CC=C(C=C1)Br.
What is the CAS number of tert-butyl N-(4-bromophenyl)carbamate?
The CAS number is 131818-17-2.
What is the hydrogen bond donor count of tert-butyl N-(4-bromophenyl)carbamate?
The hydrogen bond donor count is 1.
※ Please kindly note that our products are for research use only.