What is the molecular formula of tert-Butyl benzyl(4-hydroxybutyl)carbamate?
The molecular formula of tert-Butyl benzyl(4-hydroxybutyl)carbamate is C16H25NO3.
What is the molecular weight of tert-Butyl benzyl(4-hydroxybutyl)carbamate?
The molecular weight of tert-Butyl benzyl(4-hydroxybutyl)carbamate is 279.37 g/mol.
What is the IUPAC name of tert-Butyl benzyl(4-hydroxybutyl)carbamate?
The IUPAC name of tert-Butyl benzyl(4-hydroxybutyl)carbamate is tert-butyl N-benzyl-N-(4-hydroxybutyl)carbamate.
What is the InChI of tert-Butyl benzyl(4-hydroxybutyl)carbamate?
The InChI of tert-Butyl benzyl(4-hydroxybutyl)carbamate is InChI=1S/C16H25NO3/c1-16(2,3)20-15(19)17(11-7-8-12-18)13-14-9-5-4-6-10-14/h4-6,9-10,18H,7-8,11-13H2,1-3H3.
What is the InChIKey of tert-Butyl benzyl(4-hydroxybutyl)carbamate?
The InChIKey of tert-Butyl benzyl(4-hydroxybutyl)carbamate is LJWTWHZDQSLGOH-UHFFFAOYSA-N.
What is the canonical SMILES of tert-Butyl benzyl(4-hydroxybutyl)carbamate?
The canonical SMILES of tert-Butyl benzyl(4-hydroxybutyl)carbamate is CC(C)(C)OC(=O)N(CCCCO)CC1=CC=CC=C1.
What is the CAS number of tert-Butyl benzyl(4-hydroxybutyl)carbamate?
The CAS number of tert-Butyl benzyl(4-hydroxybutyl)carbamate is 117654-86-1.
What is the XLogP3-AA value of tert-Butyl benzyl(4-hydroxybutyl)carbamate?
The XLogP3-AA value of tert-Butyl benzyl(4-hydroxybutyl)carbamate is 2.6.
How many hydrogen bond donor counts does tert-Butyl benzyl(4-hydroxybutyl)carbamate have?
tert-Butyl benzyl(4-hydroxybutyl)carbamate has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does tert-Butyl benzyl(4-hydroxybutyl)carbamate have?
tert-Butyl benzyl(4-hydroxybutyl)carbamate has 3 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.