What is the PubChem CID of the compound?
The PubChem CID of the compound is 80083.
What is the molecular formula of the compound?
The molecular formula of the compound is C18H18N4.
What is the molecular weight of the compound?
The molecular weight of the compound is 290.4 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 4-N,4-N-bis(4-aminophenyl)benzene-1,4-diamine.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C18H18N4/c19-13-1-7-16(8-2-13)22(17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18/h1-12H,19-21H2.
What is the InChIKey of the compound?
The InChIKey of the compound is SNLFYGIUTYKKOE-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC(=CC=C1N)N(C2=CC=C(C=C2)N)C3=CC=C(C=C3)N.
What is the CAS number of the compound?
The CAS number of the compound is 5981-09-9.
What is the European Community (EC) number of the compound?
The European Community (EC) number of the compound is 227-791-7.
Is the compound canonicalized?
Yes, the compound is canonicalized.