What is the molecular formula of (+)-Cannabidiol?
The molecular formula of (+)-Cannabidiol is C21H30O2.
When was (+)-Cannabidiol created?
(+)-Cannabidiol was created on May 29, 2009.
What is the IUPAC Name of (+)-Cannabidiol?
The IUPAC Name of (+)-Cannabidiol is 2-[(1S,6S)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol.
What is the Canonical SMILES of (+)-Cannabidiol?
The Canonical SMILES of (+)-Cannabidiol is CCCCCC1=CC(=C(C(=C1)O)C2C=C(CCC2C(=C)C)C)O.
What is the InChIKey of (+)-Cannabidiol?
The InChIKey of (+)-Cannabidiol is QHMBSVQNZZTUGM-MSOLQXFVSA-N.
What is the molecular weight of (+)-Cannabidiol?
The molecular weight of (+)-Cannabidiol is 314.5 g/mol.
How many hydrogen bond donor counts does (+)-Cannabidiol have?
(+)-Cannabidiol has 2 hydrogen bond donor counts.
What is the topological polar surface area of (+)-Cannabidiol?
The topological polar surface area of (+)-Cannabidiol is 40.5 Å2.
What is the heavy atom count of (+)-Cannabidiol?
The heavy atom count of (+)-Cannabidiol is 23.
How many defined atom stereocenter counts does (+)-Cannabidiol have?
(+)-Cannabidiol has 2 defined atom stereocenter counts.
Download
