What is the PubChem CID for talinolol?
The PubChem CID for talinolol is 68770.
What is the molecular formula of talinolol?
The molecular formula of talinolol is C20H33N3O3.
What is the molecular weight of talinolol?
The molecular weight of talinolol is 363.5 g/mol.
When was talinolol created?
Talinolol was created on August 8, 2005.
What is the IUPAC name of talinolol?
The IUPAC name of talinolol is 1-[4-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]-3-cyclohexylurea.
What is the InChIKey of talinolol?
The InChIKey of talinolol is MXFWWQICDIZSOA-UHFFFAOYSA-N.
What is the canonical SMILES of talinolol?
The canonical SMILES of talinolol is CC(C)(C)NCC(COC1=CC=C(C=C1)NC(=O)NC2CCCCC2)O.
What is the CAS number of talinolol?
The CAS number of talinolol is 57460-41-0.
What is the XLogP3-AA value of talinolol?
The XLogP3-AA value of talinolol is 2.6.
How many hydrogen bond donor counts does talinolol have?
Talinolol has 4 hydrogen bond donor counts.