What is the molecular formula of Sultamicillin tosilate?
The molecular formula of Sultamicillin tosilate is C32H38N4O12S3.
What is the molecular weight of Sultamicillin tosilate?
The molecular weight of Sultamicillin tosilate is 766.9 g/mol.
What are the synonyms for Sultamicillin tosilate?
The synonyms for Sultamicillin tosilate include Bacimex, 83105-70-8, and Unacim orale.
When was Sultamicillin tosilate created and modified?
Sultamicillin tosilate was created on June 24, 2005, and last modified on December 30, 2023.
What is the IUPAC Name of Sultamicillin tosilate?
The IUPAC Name of Sultamicillin tosilate is [(2S,5R)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carbonyl]oxymethyl (2S,5R,6R)-6-[[(2R)-2-amino-2-phenylacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate;4-methylbenzenesulfonic acid.
What is the Canonical SMILES representation of Sultamicillin tosilate?
The Canonical SMILES representation of Sultamicillin tosilate is CC1=CC=C(C=C1)S(=O)(=O)O.CC1(C(N2C(S1)C(C2=O)NC(=O)C(C3=CC=CC=C3)N)C(=O)OCOC(=O)C4C(S(=O)(=O)C5N4C(=O)C5)(C)C)C.
What is the InChIKey of Sultamicillin tosilate?
The InChIKey of Sultamicillin tosilate is FFCSPKNZHGIDQM-CGAOXQFVSA-N.
What is the CAS number of Sultamicillin tosilate?
The CAS number of Sultamicillin tosilate is 83105-70-8.
How many Hydrogen Bond Donor Count does Sultamicillin tosilate have?
Sultamicillin tosilate has 3 Hydrogen Bond Donor Count.
What is the Topological Polar Surface Area of Sultamicillin tosilate?
The Topological Polar Surface Area of Sultamicillin tosilate is 279 2.