What is the molecular formula of Solway Blue RN?
The molecular formula of Solway Blue RN is C22H17N2NaO5S.
What are some synonyms of Solway Blue RN?
Some synonyms of Solway Blue RN include Acid Blue 47 and 4403-89-8.
When was Solway Blue RN created?
Solway Blue RN was created on February 5, 2008.
What is the molecular weight of Solway Blue RN?
The molecular weight of Solway Blue RN is 444.4 g/mol.
What is the IUPAC name of Solway Blue RN?
The IUPAC name of Solway Blue RN is sodium;2-[(4-amino-3-methyl-9,10-dioxoanthracen-1-yl)amino]-5-methylbenzenesulfonate.
What is the Canonical SMILES of Solway Blue RN?
The Canonical SMILES of Solway Blue RN is CC1=CC(=C(C=C1)NC2=C3C(=C(C(=C2)C)N)C(=O)C4=CC=CC=C4C3=O)S(=O)(=O)[O-].[Na+].
What is the CAS number of Solway Blue RN?
The CAS number of Solway Blue RN is 4403-89-8.
What is the hydrogen bond donor count of Solway Blue RN?
The hydrogen bond donor count of Solway Blue RN is 2.
What is the hydrogen bond acceptor count of Solway Blue RN?
The hydrogen bond acceptor count of Solway Blue RN is 7.
What is the topological polar surface area of Solway Blue RN?
The topological polar surface area of Solway Blue RN is 138 Å2.