What is the molecular formula of Solvent violet 9?
The molecular formula of Solvent violet 9 is C25H31N3O.
What is the molecular weight of Solvent violet 9?
The molecular weight of Solvent violet 9 is 389.5 g/mol.
When was Solvent violet 9 created and last modified in PubChem CID?
Solvent violet 9 was created on July 28, 2005, and last modified on December 30, 2023.
What is the IUPAC name of Solvent violet 9?
The IUPAC name of Solvent violet 9 is tris[4-(dimethylamino)phenyl]methanol.
What is the InChI of Solvent violet 9?
The InChI of Solvent violet 9 is InChI=1S/C25H31N3O/c1-26(2)22-13-7-19(8-14-22)25(29,20-9-15-23(16-10-20)27(3)4)21-11-17-24(18-12-21)28(5)6/h7-18,29H,1-6H3.
What is the InChIKey of Solvent violet 9?
The InChIKey of Solvent violet 9 is QFVDKARCPMTZCS-UHFFFAOYSA-N.
What is the Canonical SMILES of Solvent violet 9?
The Canonical SMILES of Solvent violet 9 is CN(C)C1=CC=C(C=C1)C(C2=CC=C(C=C2)N(C)C)(C3=CC=C(C=C3)N(C)C)O.
What is the CAS number of Solvent violet 9?
The CAS number of Solvent violet 9 is 467-63-0.
How many hydrogen bond donor counts does Solvent violet 9 have?
Solvent violet 9 has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does Solvent violet 9 have?
Solvent violet 9 has 4 hydrogen bond acceptor counts.