What is the molecular formula of Solvent Green 3?
The molecular formula of Solvent Green 3 is C28H22N2O2.
What is the molecular weight of Solvent Green 3?
The molecular weight of Solvent Green 3 is 418.5 g/mol.
What is the IUPAC name of Solvent Green 3?
The IUPAC name of Solvent Green 3 is 1,4-bis(4-methylanilino)anthracene-9,10-dione.
What is the Canonical SMILES representation of Solvent Green 3?
The Canonical SMILES representation of Solvent Green 3 is CC1=CC=C(C=C1)NC2=C3C(=C(C=C2)NC4=CC=C(C=C4)C)C(=O)C5=CC=CC=C5C3=O.
What is the InChIKey of Solvent Green 3?
The InChIKey of Solvent Green 3 is TVRGPOFMYCMNRB-UHFFFAOYSA-N.
What is the CAS number of Solvent Green 3?
The CAS number of Solvent Green 3 is 128-80-3.
How many hydrogen bond donor counts does Solvent Green 3 have?
Solvent Green 3 has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Solvent Green 3 have?
Solvent Green 3 has 4 hydrogen bond acceptor counts.
What is the topological polar surface area of Solvent Green 3?
The topological polar surface area of Solvent Green 3 is 58.2?2.
How many rotatable bond counts does Solvent Green 3 have?
Solvent Green 3 has 4 rotatable bond counts.