What is the molecular formula of Solvent Brown 5?
The molecular formula of Solvent Brown 5 is C20H14N2O.
What is the structure of Solvent Brown 5?
The structure of Solvent Brown 5 is not provided in the reference.
What is the IUPAC name of Solvent Brown 5?
The IUPAC name of Solvent Brown 5 is 4-(naphthalen-1-yldiazenyl)naphthalen-1-ol.
What is the InChI of Solvent Brown 5?
The InChI of Solvent Brown 5 is InChI=1S/C20H14N2O/c23-20-13-12-19(16-9-3-4-10-17(16)20)22-21-18-11-5-7-14-6-1-2-8-15(14)18/h1-13,23H.
What is the InChIKey of Solvent Brown 5?
The InChIKey of Solvent Brown 5 is NSWKKBKROCMOHA-UHFFFAOYSA-N.
What is the canonical SMILES of Solvent Brown 5?
The canonical SMILES of Solvent Brown 5 is C1=CC=C2C(=C1)C=CC=C2N=NC3=CC=C(C4=CC=CC=C43)O.
What is the CAS number of Solvent Brown 5?
The CAS number of Solvent Brown 5 is 2653-72-7.
What is the molecular weight of Solvent Brown 5?
The molecular weight of Solvent Brown 5 is 298.3 g/mol.
What is the XLogP3-AA value of Solvent Brown 5?
The XLogP3-AA value of Solvent Brown 5 is 5.8.
Is Solvent Brown 5 a canonicalized compound?
Yes, Solvent Brown 5 is a canonicalized compound.