What is the molecular formula of Solvent Blue 5?
The molecular formula of Solvent Blue 5 is C33H41N3O.
What is the molecular weight of Solvent Blue 5?
The molecular weight of Solvent Blue 5 is 495.7 g/mol.
What is the IUPAC name of Solvent Blue 5?
The IUPAC name of Solvent Blue 5 is bis[4-(diethylamino)phenyl]-[4-(ethylamino)naphthalen-1-yl]methanol.
What is the InChIKey of Solvent Blue 5?
The InChIKey of Solvent Blue 5 is ZDMVLXPCERUWIR-UHFFFAOYSA-N.
What is the canonical SMILES of Solvent Blue 5?
The canonical SMILES of Solvent Blue 5 is CCNC1=CC=C(C2=CC=CC=C21)C(C3=CC=C(C=C3)N(CC)CC)(C4=CC=C(C=C4)N(CC)CC)O.
What is the CAS number of Solvent Blue 5?
The CAS number of Solvent Blue 5 is 1325-86-6.
What is the XLogP3-AA value of Solvent Blue 5?
The XLogP3-AA value of Solvent Blue 5 is 7.5.
How many hydrogen bond donor counts does Solvent Blue 5 have?
Solvent Blue 5 has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Solvent Blue 5 have?
Solvent Blue 5 has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does Solvent Blue 5 have?
Solvent Blue 5 has 11 rotatable bond counts.