What is the PubChem CID of Solketyl chloroformate?
The PubChem CID of Solketyl chloroformate is 15611443.
What is the molecular formula of Solketyl chloroformate?
The molecular formula of Solketyl chloroformate is C7H11ClO4.
What are some synonyms of Solketyl chloroformate?
Some synonyms of Solketyl chloroformate include 28863-62-9, (2,2-dimethyl-1,3-dioxolan-4-yl)methyl carbonochloridate, 2,2-dimethyl-1,3-dioxolan-4-ylmethyl chloroformate, and Carbonochloridic acid (2,2-dimethyl-1,3-dioxolan-4-yl)methyl ester.
What is the molecular weight of Solketyl chloroformate?
The molecular weight of Solketyl chloroformate is 194.61 g/mol.
When was Solketyl chloroformate created in PubChem?
Solketyl chloroformate was created in PubChem on February 12, 2007.
When was Solketyl chloroformate last modified in PubChem?
Solketyl chloroformate was last modified in PubChem on December 2, 2023.
What is the IUPAC name of Solketyl chloroformate?
The IUPAC name of Solketyl chloroformate is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl carbonochloridate.
What is the InChI of Solketyl chloroformate?
The InChI of Solketyl chloroformate is InChI=1S/C7H11ClO4/c1-7(2)11-4-5(12-7)3-10-6(8)9/h5H,3-4H2,1-2H3.
What is the canonical SMILES of Solketyl chloroformate?
The canonical SMILES of Solketyl chloroformate is CC1(OCC(O1)COC(=O)Cl)C.
What is the XLogP3-AA value of Solketyl chloroformate?
The XLogP3-AA value of Solketyl chloroformate is 1.4.