Sodiumtetrakis(pentafluorophenyl)borate

• Catalog Number: ACM149213650
• Product Name: Sodiumtetrakis(pentafluorophenyl)borate
• CAS: 149213-65-0
• Category: Heterocyclic Organic Compound
• Synonyms: Sodiumtetrakis(pentafluorophenyl)borate;Borate(1-), tris(pentafluorophenyl)phenyl-,sodiuM, (T-4)- (9CI);sodiuM tetrakis(perfluorophenyl)borate
• Molecular Weight: 702.025634
• Molecular Formula: C₂₄BF₂₀Na

Custom Q&A

What is the molecular formula of sodium tetrakis(pentafluorophenyl)borate?

The molecular formula of sodium tetrakis(pentafluorophenyl)borate is C24BF20Na.

What is the molecular weight of sodium tetrakis(pentafluorophenyl)borate?

The molecular weight of sodium tetrakis(pentafluorophenyl)borate is 702.0 g/mol.

What are some synonyms for sodium tetrakis(pentafluorophenyl)borate?

Some synonyms for sodium tetrakis(pentafluorophenyl)borate include sodium tetrakis(perfluorophenyl)borate and sodium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.

When was sodium tetrakis(pentafluorophenyl)borate created?

Sodium tetrakis(pentafluorophenyl)borate was created on February 5, 2008.

What are the component compounds of sodium tetrakis(pentafluorophenyl)borate?

The component compounds of sodium tetrakis(pentafluorophenyl)borate are sodium and tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.

What is the Canonical SMILES representation of sodium tetrakis(pentafluorophenyl)borate?

The Canonical SMILES representation of sodium tetrakis(pentafluorophenyl)borate is [B-](C1=C(C(=C(C(=C1F)F)F)F)F)(C2=C(C(=C(C(=C2F)F)F)F)F)(C3=C(C(=C(C(=C3F)F)F)F)F)C4=C(C(=C(C(=C4F)F)F)F)F.[Na+].

What is the InChIKey of sodium tetrakis(pentafluorophenyl)borate?

The InChIKey of sodium tetrakis(pentafluorophenyl)borate is NXSPYLCTDFECPN-UHFFFAOYSA-N.

How many hydrogen bond acceptors are there in sodium tetrakis(pentafluorophenyl)borate?

There are 21 hydrogen bond acceptors in sodium tetrakis(pentafluorophenyl)borate.

What is the exact mass of sodium tetrakis(pentafluorophenyl)borate?

The exact mass of sodium tetrakis(pentafluorophenyl)borate is 701.9671377 g/mol.

Is the compound canonicalized?

Yes, the compound is canonicalized.