Sodium-N-Methyl-N-Oleyl Taurate

• CAS: 137-20-2
• Catalog Number: ACM137202
• Category: Anionic Surfactants
• Molecular Weight: 425.60137
• Molecular Formula: C₂₁H₄₀NNaO₄S
• Synonyms: 2-(methyl(1-oxo-9-octadecenyl)amino)-,sodiumsalt,(z)-ethanesulfonicaci;2-(methyl(1-oxo-9-octadecenyl)amino)-,sodiumsalt,z-ethanesulfonicaci;2-[methyl(1-oxo-9-octadecenyl)amino]-,sodiumsalt,(z)-ethanesulfonicaci;2-[methyl(1-oxo-9-octadecenyl)amino]-,sodiumsalt,(Z)-Ethanesulfonicacid;adinolt;alkylsodiumn-methyltaurate;concogel2conc;concogel2conc.

Custom Q&A

What is the molecular formula of Sodium-N-Methyl-N-Oleyl Taurate?

The molecular formula is C21H40NNaO4S.

What is the molecular weight of Sodium-N-Methyl-N-Oleyl Taurate?

The molecular weight is 425.6 g/mol.

What are some synonyms for Sodium-N-Methyl-N-Oleyl Taurate?

Some synonyms include Sodium methyl oleoyl taurate and Igepon T 77.

What is the IUPAC name of Sodium-N-Methyl-N-Oleyl Taurate?

The IUPAC name is sodium;2-[methyl-[(Z)-octadec-9-enoyl]amino]ethanesulfonate.

What is the InChI of Sodium-N-Methyl-N-Oleyl Taurate?

The InChI is InChI=1S/C21H41NO4S.Na/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(23)22(2)19-20-27(24,25)26;/h10-11H,3-9,12-20H2,1-2H3,(H,24,25,26);/q;+1/p-1/b11-10-.

What is the Canonical SMILES of Sodium-N-Methyl-N-Oleyl Taurate?

The Canonical SMILES is CCCCCCCCC=CCCCCCCCC(=O)N(C)CCS(=O)(=O)[O-].[Na+].

How many Hydrogen Bond Acceptor Count does Sodium-N-Methyl-N-Oleyl Taurate have?

It has 4 Hydrogen Bond Acceptor Count.

What is the exact mass of Sodium-N-Methyl-N-Oleyl Taurate?

The exact mass is 425.25757421 g/mol.

How many Rotatable Bond Count does Sodium-N-Methyl-N-Oleyl Taurate have?

It has 18 Rotatable Bond Count.

What is the topological polar surface area of Sodium-N-Methyl-N-Oleyl Taurate?

The topological polar surface area is 85.9 Å2.