What is the molecular formula of sodium edetate?
The molecular formula of sodium edetate is C10H12N2O8Na4 ((NaOOCCH2)2NCH2)2.
What is the molecular weight of sodium edetate?
The molecular weight of sodium edetate is 380.17 g/mol.
What is the parent compound of sodium edetate?
The parent compound of sodium edetate is edetic acid (CID 6049).
What are the synonyms for sodium edetate?
Some synonyms for sodium edetate include edetate sodium, Sodium edetate 64-02-8, EDTA tetrasodium, and Ethylenediaminetetraacetic acid tetrasodium salt.
What is the IUPAC name of sodium edetate?
The IUPAC name of sodium edetate is tetrasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate.
What is the InChI of sodium edetate?
The InChI of sodium edetate is InChI=1S/C10H16N2O8.4Na/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;;;/q;4*+1/p-4.
What is the InChIKey of sodium edetate?
The InChIKey of sodium edetate is UEUXEKPTXMALOB-UHFFFAOYSA-J.
What is the canonical SMILES of sodium edetate?
The canonical SMILES of sodium edetate is C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[Na+].[Na+].[Na+].[Na+].
What is the CAS number of sodium edetate?
The CAS number of sodium edetate is 64-02-8.
What is the ChEMBL ID of sodium edetate?
The ChEMBL ID of sodium edetate is CHEMBL2104344.