What is the molecular formula of Phthalocyanine Tin(II)?
The molecular formula is C32H16N8Sn.
What are the synonyms for Phthalocyanine Tin(II)?
The synonyms are Phthalocyanine Tin(II), 2,11,20,29,37,38-Hexaza-39,40-diazanidanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetraconta-1,3,5,7,9,11,13,15,17,19,21(38),22,24,26,28,30(37),31,33,35-nonadecaene;tin(2+), [Phthalocyaninato(2-)]tin, DTXSID00424848, and tin(2+) phthalocyanine-29,31-diide.
What is the molecular weight of Phthalocyanine Tin(II)?
The molecular weight is 631.2 g/mol.
What is the parent compound of Phthalocyanine Tin(II)?
The parent compound is Phthalocyanine.
What are the component compounds of Phthalocyanine Tin(II)?
The component compounds are Phthalocyanine, Tin powder, and 31h-Phthalocyanine.
When was Phthalocyanine Tin(II) created?
It was created on May 3, 2006.
When was Phthalocyanine Tin(II) last modified?
It was last modified on October 21, 2023.
What is the IUPAC name of Phthalocyanine Tin(II)?
The IUPAC name is 2,11,20,29,37,39-hexaza-38,40-diazanidanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetraconta-1,3,5,7,9,11,13,15,17,19(39),20,22,24,26,28,30(37),31,33,35-nonadecaene;tin(2+).
What is the InChI of Phthalocyanine Tin(II)?
The InChI is InChI=1S/C32H16N8.Sn/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25;/h1-16H;/q-2;+2.
What is the CAS number of Phthalocyanine Tin(II)?
The CAS number is 15304-57-1.