What is the molecular formula of the compound with PubChem CID 74071?
The molecular formula is C21H24O2.
What is the molecular weight of the compound?
The molecular weight is 308.4 g/mol.
What is the IUPAC name of the compound?
The IUPAC name is 1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5'-diol.
What is the InChI key of the compound?
The InChI key is SICLLPHPVFCNTJ-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES is CC1(CC2(CC(C3=C2C=C(C=C3)O)(C)C)C4=C1C=CC(=C4)O)C.
What is the CAS number of the compound?
The CAS number is 1568-80-5.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value is 5.8.
How many hydrogen bond donor counts does the compound have?
The compound has 2 hydrogen bond donor counts.
How many rotatable bond counts does the compound have?
The compound has 0 rotatable bond counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.