Sertaconazole nitrate

• CAS: 99592-32-2
• Catalog Number: ACM99592322
• Category: Other Products
• Molecular Weight: 437.77
• Molecular Formula: C₂₀H₁₅Cl₃N₂OS
• Synonyms: 1-(2-((7-chlorobenzo(b)thien-3-yl)methoxy)-2-(2,4-dichlorophenyl)ethyl)-1h-i;1h-imidazole,1-(2-((7-chlorobenzo(b)thien-3-yl)methoxy)-2-(2,4-dichlorophenyl);7-chloro-3-(1-(2,4-dichlorophenyl)-2-(1h-imidazol-1-yl)ethoxy-methyl)benzo(b;7-cloro-3-(1-(2,4-diclorofenil)-2-(1h-imidazol-1-il)etoxi-metil)benzo(b)tiof;eno;fi-7045;SERTACONAZOLE;7-CHLORO-3-[1-(2,4-DICHLOROPHENYL)-2-(1H-IMIDAZOL-1-YL)ETHOXY-METHYL] BENZO[B]THIOPHENE NITRATE

Custom Q&A

What is the molecular formula of sertaconazole nitrate?

The molecular formula of sertaconazole nitrate is C20H16Cl3N3O4S.

What is the molecular weight of sertaconazole nitrate?

The molecular weight of sertaconazole nitrate is 500.8 g/mol.

What is the IUPAC name of sertaconazole nitrate?

The IUPAC name of sertaconazole nitrate is 1-[2-[(7-chloro-1-benzothiophen-3-yl)methoxy]-2-(2,4-dichlorophenyl)ethyl]imidazole; nitric acid.

How does sertaconazole nitrate inhibit fungal growth?

Sertaconazole nitrate inhibits fungal cytochrome P-450 sterol C-14 alpha-demethylation, leading to the accumulation of fungal 14 alpha-methyl sterols and inhibition of ergosterol synthesis in fungal cells.

What is the InChIKey of sertaconazole nitrate?

The InChIKey of sertaconazole nitrate is HAAITRDZHUANGT-UHFFFAOYSA-N.

What is the canonical SMILES representation of sertaconazole nitrate?

The canonical SMILES representation of sertaconazole nitrate is C1=CC2=C(C(=C1)Cl)SC=C2COC(CN3C=CN=C3)C4=C(C=C(C=C4)Cl)Cl.[N+](=O)(O)[O-].

What is the CAS number for sertaconazole nitrate?

The CAS number for sertaconazole nitrate is 99592-39-9.

How many hydrogen bond donor counts does sertaconazole nitrate have?

Sertaconazole nitrate has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does sertaconazole nitrate have?

Sertaconazole nitrate has 6 hydrogen bond acceptor counts.

What is the topological polar surface area of sertaconazole nitrate?

The topological polar surface area of sertaconazole nitrate is 121 Å2.