What is the molecular formula of selachyl alcohol?
The molecular formula of selachyl alcohol is C21H42O3.
What is the molecular weight of selachyl alcohol?
The molecular weight of selachyl alcohol is 342.6 g/mol.
When was selachyl alcohol created?
Selachyl alcohol was created on June 24, 2005.
What is the IUPAC name of selachyl alcohol?
The IUPAC name of selachyl alcohol is 3-[(Z)-octadec-9-enoxy]propane-1,2-diol.
What is the InChI of selachyl alcohol?
The InChI of selachyl alcohol is InChI=1S/C21H42O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24-20-21(23)19-22/h9-10,21-23H,2-8,11-20H2,1H3/b10-9-.
What is the canonical SMILES of selachyl alcohol?
The canonical SMILES of selachyl alcohol is CCCCCCCCC=CCCCCCCCCOCC(CO)O.
What is the CAS number of selachyl alcohol?
The CAS number of selachyl alcohol is 593-31-7.
What is the XLogP3-AA value of selachyl alcohol?
The XLogP3-AA value of selachyl alcohol is 6.7.
How many hydrogen bond donor counts does selachyl alcohol have?
Selachyl alcohol has 2 hydrogen bond donor counts.
How many rotatable bond counts does selachyl alcohol have?
Selachyl alcohol has 19 rotatable bond counts.