What is the molecular formula of Salvianolic acid B?
The molecular formula of Salvianolic acid B is C36H30O16.
What are the synonyms of Salvianolic acid B?
The synonyms of Salvianolic acid B are Lithospermic acid B, Dan Shen Suan B, and Danfensuan B.
What is the molecular weight of Salvianolic acid B?
The molecular weight of Salvianolic acid B is 718.6 g/mol.
What is the role of Salvianolic acid B?
Salvianolic acid B has multiple roles, including being an antioxidant, free radical scavenging compound, anti-inflammatory agent, hypoglycemic agent, osteogenesis regulator, apoptosis inducer, hepatoprotective agent, neuroprotective agent, cardioprotective agent, autophagy inhibitor, antidepressant, and antineoplastic agent.
What is Salvianolic acid B classified as?
Salvianolic acid B is classified as a polyphenol, a member of 1-benzofurans, an enoate ester, a dicarboxylic acid, and a member of catechols.
Where is Lithospermic acid B found?
Lithospermic acid B is a natural product found in Salvia deserti, Meehania fargesii, and other organisms.
What is the IUPAC name of Salvianolic acid B?
The IUPAC name of Salvianolic acid B is (2R)-2-[(E)-3-[(2S,3S)-3-[(1R)-1-carboxy-2-(3,4-dihydroxyphenyl)ethoxy]carbonyl-2-(3,4-dihydroxyphenyl)-7-hydroxy-2,3-dihydro-1-benzofuran-4-yl]prop-2-enoyl]oxy-3-(3,4-dihydroxyphenyl)propanoic acid.
What is the InChIKey of Salvianolic acid B?
The InChIKey of Salvianolic acid B is SNKFFCBZYFGCQN-VWUOOIFGSA-N.
What is the Canonical SMILES of Salvianolic acid B?
The Canonical SMILES of Salvianolic acid B is C1=CC(=C(C=C1CC(C(=O)O)OC(=O)C=CC2=C3C(C(OC3=C(C=C2)O)C4=CC(=C(C=C4)O)O)C(=O)OC(CC5=CC(=C(C=C5)O)O)C(=O)O)O)O.
What is the CAS number of Salvianolic acid B?
The CAS number of Salvianolic acid B is 121521-90-2.