What is the molecular formula of Salirasib?
The molecular formula of Salirasib is C22H30O2S.
What is the molecular weight of Salirasib?
The molecular weight of Salirasib is 358.5 g/mol.
What is the IUPAC name of Salirasib?
The IUPAC name of Salirasib is 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoic acid.
What is the InChI of Salirasib?
The InChI of Salirasib is InChI=1S/C22H30O2S/c1-17(2)9-7-10-18(3)11-8-12-19(4)15-16-25-21-14-6-5-13-20(21)22(23)24/h5-6,9,11,13-15H,7-8,10,12,16H2,1-4H3,(H,23,24)/b18-11+,19-15+.
What is the InChIKey of Salirasib?
The InChIKey of Salirasib is WUILNKCFCLNXOK-CFBAGHHKSA-N.
What is the CAS number of Salirasib?
The CAS number of Salirasib is 162520-00-5.
What is the ChEMBL ID of Salirasib?
The ChEMBL ID of Salirasib is CHEMBL23293.
What is the UNII of Salirasib?
The UNII of Salirasib is MZH0OM550M.
What is the NCI Thesaurus Code of Salirasib?
The NCI Thesaurus Code of Salirasib is C71146.
What is the XLogP3-AA value of Salirasib?
The XLogP3-AA value of Salirasib is 7.2.