What is the molecular formula of (S)-2-Methyl glycidol?
The molecular formula of (S)-2-Methyl glycidol is C4H8O2.
What is the molecular weight of (S)-2-Methyl glycidol?
The molecular weight of (S)-2-Methyl glycidol is 88.11 g/mol.
What is the IUPAC name of (S)-2-Methyl glycidol?
The IUPAC name of (S)-2-Methyl glycidol is [(2S)-2-methyloxiran-2-yl]methanol.
What are the synonyms of (S)-2-Methyl glycidol?
The synonyms of (S)-2-Methyl glycidol include 86884-90-4, [(2S)-2-methyloxiran-2-yl]methanol, (S)-(2-methyloxiran-2-yl)methanol, and (2S)-(+)-2-Methyl-2,3-epoxy-1-propanol.
What is the InChI of (S)-2-Methyl glycidol?
The InChI of (S)-2-Methyl glycidol is InChI=1S/C4H8O2/c1-4(2-5)3-6-4/h5H,2-3H2,1H3/t4-/m0/s1.
What is the InChIKey of (S)-2-Methyl glycidol?
The InChIKey of (S)-2-Methyl glycidol is AAVHHYWBSVSPPN-BYPYZUCNSA-N.
What is the XLogP3-AA value of (S)-2-Methyl glycidol?
The XLogP3-AA value of (S)-2-Methyl glycidol is -0.6.
How many hydrogen bond donor counts does (S)-2-Methyl glycidol have?
(S)-2-Methyl glycidol has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does (S)-2-Methyl glycidol have?
(S)-2-Methyl glycidol has 2 hydrogen bond acceptor counts.
How many rotatable bond counts does (S)-2-Methyl glycidol have?
(S)-2-Methyl glycidol has 1 rotatable bond count.