What is the molecular formula of S-2-bromopropionic acid?
The molecular formula of S-2-bromopropionic acid is C3H5BrO2.
What is the molecular weight of S-2-bromopropionic acid?
The molecular weight of S-2-bromopropionic acid is 152.97 g/mol.
What is the IUPAC name of S-2-bromopropionic acid?
The IUPAC name of S-2-bromopropionic acid is (2S)-2-bromopropanoic acid.
What is the InChI of S-2-bromopropionic acid?
The InChI of S-2-bromopropionic acid is InChI=1S/C3H5BrO2/c1-2(4)3(5)6/h2H,1H3,(H,5,6)/t2-/m0/s1.
What is the InChIKey of S-2-bromopropionic acid?
The InChIKey of S-2-bromopropionic acid is MONMFXREYOKQTI-REOHCLBHSA-N.
What is the canonical SMILES of S-2-bromopropionic acid?
The canonical SMILES of S-2-bromopropionic acid is CC(C(=O)O)Br.
How many hydrogen bond donor counts does S-2-bromopropionic acid have?
S-2-bromopropionic acid has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does S-2-bromopropionic acid have?
S-2-bromopropionic acid has 2 hydrogen bond acceptor counts.
What is the topological polar surface area of S-2-bromopropionic acid?
The topological polar surface area of S-2-bromopropionic acid is 37.3Ų.
Is S-2-bromopropionic acid a canonicalized compound?
Yes, S-2-bromopropionic acid is a canonicalized compound.