What is the molecular formula of S-2--bromobutyric acid?
The molecular formula of S-2--bromobutyric acid is C4H7BrO2.
What is the molecular weight of S-2--bromobutyric acid?
The molecular weight of S-2--bromobutyric acid is 167.00 g/mol.
When was S-2--bromobutyric acid created and modified in PubChem?
S-2--bromobutyric acid was created in PubChem on January 25, 2006, and last modified on December 2, 2023.
What is the IUPAC name of S-2--bromobutyric acid?
The IUPAC name of S-2--bromobutyric acid is (2S)-2-bromobutanoic acid.
What is the InChI of S-2--bromobutyric acid?
The InChI of S-2--bromobutyric acid is InChI=1S/C4H7BrO2/c1-2-3(5)4(6)7/h3H,2H2,1H3,(H,6,7)/t3-/m0/s1.
What is the InChIKey of S-2--bromobutyric acid?
The InChIKey of S-2--bromobutyric acid is YAQLSKVCTLCIIE-VKHMYHEASA-N.
What is the canonical SMILES of S-2--bromobutyric acid?
The canonical SMILES of S-2--bromobutyric acid is CCC(C(=O)O)Br.
What is the isomeric SMILES of S-2--bromobutyric acid?
The isomeric SMILES of S-2--bromobutyric acid is CC[C@@H](C(=O)O)Br.
What are the other identifiers of S-2--bromobutyric acid?
The other identifiers of S-2--bromobutyric acid are CAS: 32659-49-7, UNII: XK125R6KHN, DSSTox Substance ID: DTXSID40186332, Nikkaji Number: J57.581J, and Wikidata: Q27293869.
What is the XLogP3 value of S-2--bromobutyric acid?
The XLogP3 value of S-2--bromobutyric acid is 1.4.