The molecular weight of the compound is 201.06 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is (1S)-1-(3-bromophenyl)ethanol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C8H9BrO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,1H3/t6-/m0/s1.
What is the InChIKey of the compound?
The InChIKey of the compound is ULMJQMDYAOJNCC-LURJTMIESA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC(C1=CC(=CC=C1)Br)O.
What are the synonyms of the compound?
The synonyms of the compound are (S)-1-(3-Bromophenyl)ethanol, 134615-22-8, (1S)-1-(3-bromophenyl)ethanol, (1S)-1-(3-bromophenyl)ethan-1-ol, MFCD06201859.
What is the CAS number of the compound?
The CAS number of the compound is 134615-22-8.
What is the European Community (EC) number of the compound?
The European Community (EC) number of the compound is 839-535-7.
Is the compound canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.