What is the molecular formula of Reveromycin A?
The molecular formula of Reveromycin A is C36H52O11.
What are some synonyms for Reveromycin A?
Some synonyms for Reveromycin A are 134615-37-5 and CHEMBL332724.
What is the molecular weight of Reveromycin A?
The molecular weight of Reveromycin A is 660.8 g/mol.
When was Reveromycin A created?
Reveromycin A was created on October 25, 2006.
What is the structure of Reveromycin A?
The structure of Reveromycin A can be viewed in the reference link provided.
What is the IUPAC name of Reveromycin A?
The IUPAC name of Reveromycin A is (2E,4S,5S,6E,8E)-10-[(2S,3R,6S,8R,9S)-3-butyl-2-[(1E,3E)-4-carboxy-3-methylbuta-1,3-dienyl]-3-(3-carboxypropanoyloxy)-9-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]-5-hydroxy-4,8-dimethyldeca-2,6,8-trienoic acid.
What is the InChI of Reveromycin A?
The InChI of Reveromycin A is InChI=1S/C36H52O11/c1-6-7-19-35(47-34(44)17-16-32(40)41)21-22-36(46-30(35)14-10-25(3)23-33(42)43)20-18-27(5)29(45-36)13-9-24(2)8-12-28(37)26(4)11-15-31(38)39/h8-12,14-15,23,26-30,37H,6-7,13,16-22H2,1-5H3,(H,38,39)(H,40,41)(H,42,43)/b12-8+,14-10+,15-11+,24-9+,25-23+/t26-,27-,28-,29+,30-,35+,36-/m0/s1.
What is the InChIKey of Reveromycin A?
The InChIKey of Reveromycin A is ZESGNAJSBDILTB-OXVOKJAASA-N.
What is the CAS number of Reveromycin A?
The CAS number of Reveromycin A is 134615-37-5.
What is the ChEMBL ID of Reveromycin A?
The ChEMBL ID of Reveromycin A is CHEMBL332724.