What is the molecular formula of (R,S)-Fmoc-3-amino-3-(2-naphthyl)-propionic acid?
The molecular formula is C28H23NO4.
What are the synonyms for (R,S)-Fmoc-3-amino-3-(2-naphthyl)-propionic acid?
The synonyms are 269078-81-1, Fmoc-3-amino-3-(2-naphthyl)propionic acid, 3-({[(9H-FLUOREN-9-YL)METHOXY]CARBONYL}AMINO)-3-(NAPHTHALEN-2-YL)PROPANOIC ACID, 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-2-ylpropanoic acid.
What is the molecular weight of (R,S)-Fmoc-3-amino-3-(2-naphthyl)-propionic acid?
The molecular weight is 437.5 g/mol.
When was (R,S)-Fmoc-3-amino-3-(2-naphthyl)-propionic acid created?
It was created on July 19, 2005.
What is the IUPAC name of (R,S)-Fmoc-3-amino-3-(2-naphthyl)-propionic acid?
The IUPAC name is 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-2-ylpropanoic acid.
What is the InChI key of (R,S)-Fmoc-3-amino-3-(2-naphthyl)-propionic acid?
The InChI key is WMWTTXWFWZKELH-UHFFFAOYSA-N.
What is the canonical SMILES representation of (R,S)-Fmoc-3-amino-3-(2-naphthyl)-propionic acid?
The canonical SMILES representation is C1=CC=C2C=C(C=CC2=C1)C(CC(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35.
How many hydrogen bond donor atoms are there in (R,S)-Fmoc-3-amino-3-(2-naphthyl)-propionic acid?
There are 2 hydrogen bond donor atoms.
How many rotatable bonds are there in (R,S)-Fmoc-3-amino-3-(2-naphthyl)-propionic acid?
There are 7 rotatable bonds.
Is (R,S)-Fmoc-3-amino-3-(2-naphthyl)-propionic acid a canonicalized compound?
Yes, it is a canonicalized compound.
※ Please kindly note that our products are for research use only.