What is the molecular formula of (R,S)-Boc-1-aminoindane-1-carboxylic acid?
The molecular formula of (R,S)-Boc-1-aminoindane-1-carboxylic acid is C15H19NO4.
What is the molecular weight of (R,S)-Boc-1-aminoindane-1-carboxylic acid?
The molecular weight of (R,S)-Boc-1-aminoindane-1-carboxylic acid is 277.31 g/mol.
What is the IUPAC name of (R,S)-Boc-1-aminoindane-1-carboxylic acid?
The IUPAC name of (R,S)-Boc-1-aminoindane-1-carboxylic acid is 1-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydroindene-1-carboxylic acid.
What is the InChI of (R,S)-Boc-1-aminoindane-1-carboxylic acid?
The InChI of (R,S)-Boc-1-aminoindane-1-carboxylic acid is InChI=1S/C15H19NO4/c1-14(2,3)20-13(19)16-15(12(17)18)9-8-10-6-4-5-7-11(10)15/h4-7H,8-9H2,1-3H3,(H,16,19)(H,17,18).
What is the InChIKey of (R,S)-Boc-1-aminoindane-1-carboxylic acid?
The InChIKey of (R,S)-Boc-1-aminoindane-1-carboxylic acid is UZCCJRDJRMVGLU-UHFFFAOYSA-N.
What is the canonical SMILES of (R,S)-Boc-1-aminoindane-1-carboxylic acid?
The canonical SMILES of (R,S)-Boc-1-aminoindane-1-carboxylic acid is CC(C)(C)OC(=O)NC1(CCC2=CC=CC=C21)C(=O)O.
What is the CAS number of (R,S)-Boc-1-aminoindane-1-carboxylic acid?
The CAS number of (R,S)-Boc-1-aminoindane-1-carboxylic acid is 214139-26-1.
What is the XLogP3-AA value of (R,S)-Boc-1-aminoindane-1-carboxylic acid?
The XLogP3-AA value of (R,S)-Boc-1-aminoindane-1-carboxylic acid is 2.4.
What is the hydrogen bond donor count of (R,S)-Boc-1-aminoindane-1-carboxylic acid?
The hydrogen bond donor count of (R,S)-Boc-1-aminoindane-1-carboxylic acid is 2.
What is the hydrogen bond acceptor count of (R,S)-Boc-1-aminoindane-1-carboxylic acid?
The hydrogen bond acceptor count of (R,S)-Boc-1-aminoindane-1-carboxylic acid is 4.
※ Please kindly note that our products are for research use only.