What is the molecular formula of (R)-BoroPhe-(+)-Pinanediol-HCl?
The molecular formula is C18H27BClNO2.
What is the molecular weight of (R)-BoroPhe-(+)-Pinanediol-HCl?
The molecular weight is 335.7 g/mol.
What is the IUPAC name of (R)-BoroPhe-(+)-Pinanediol-HCl?
The IUPAC name is (1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine;hydrochloride.
What is the canonical SMILES of (R)-BoroPhe-(+)-Pinanediol-HCl?
The canonical SMILES is B1(OC2CC3CC(C3(C)C)C2(O1)C)C(CC4=CC=CC=C4)N.Cl.
What is the InChI of (R)-BoroPhe-(+)-Pinanediol-HCl?
The InChI is InChI=1S/C18H26BNO2.ClH/c1-17(2)13-10-14(17)18(3)15(11-13)21-19(22-18)16(20)9-12-7-5-4-6-8-12;/h4-8,13-16H,9-11,20H2,1-3H3;1H/t13-,14-,15+,16-,18-;/m0./s1.
What is the hydrogen bond donor count of (R)-BoroPhe-(+)-Pinanediol-HCl?
The hydrogen bond donor count is 2.
What is the hydrogen bond acceptor count of (R)-BoroPhe-(+)-Pinanediol-HCl?
The hydrogen bond acceptor count is 3.
What is the rotatable bond count of (R)-BoroPhe-(+)-Pinanediol-HCl?
The rotatable bond count is 3.
What is the exact mass of (R)-BoroPhe-(+)-Pinanediol-HCl?
The exact mass is 335.1823370 g/mol.
Is (R)-BoroPhe-(+)-Pinanediol-HCl a canonicalized compound?
Yes, (R)-BoroPhe-(+)-Pinanediol-HCl is canonicalized.
※ Please kindly note that our products are for research use only.