What is the molecular formula of (R)-Amino-cyclopropyl-acetic acid methyl ester?
The molecular formula is C6H11NO2.
What are the synonyms of (R)-Amino-cyclopropyl-acetic acid methyl ester?
The synonyms are (R)-Amino-cyclopropyl-acetic acid methyl ester, 700342-85-4, METHYL (2R)-2-AMINO-2-CYCLOPROPYLACETATE, SCHEMBL1694458.
What is the molecular weight of (R)-Amino-cyclopropyl-acetic acid methyl ester?
The molecular weight is 129.16 g/mol.
When was (R)-Amino-cyclopropyl-acetic acid methyl ester created and modified in PubChem?
It was created on May 29, 2009, and modified on November 25, 2023.
What is the IUPAC name of (R)-Amino-cyclopropyl-acetic acid methyl ester?
The IUPAC name is methyl (2R)-2-amino-2-cyclopropylacetate.
What is the InChI of (R)-Amino-cyclopropyl-acetic acid methyl ester?
The InChI is InChI=1S/C6H11NO2/c1-9-6(8)5(7)4-2-3-4/h4-5H,2-3,7H2,1H3/t5-/m1/s1.
What is the InChIKey of (R)-Amino-cyclopropyl-acetic acid methyl ester?
The InChIKey is NZIFONPEUDXXJV-RXMQYKEDSA-N.
What is the canonical SMILES of (R)-Amino-cyclopropyl-acetic acid methyl ester?
The canonical SMILES is COC(=O)C(C1CC1)N.
What are the computed properties of (R)-Amino-cyclopropyl-acetic acid methyl ester?
The computed properties include molecular weight, XLogP3-AA, hydrogen bond donor count, hydrogen bond acceptor count, rotatable bond count, exact mass, monoisotopic mass, topological polar surface area, heavy atom count, formal charge, complexity, isotope atom count, defined atom stereocenter count, undefined atom stereocenter count, defined bond stereocenter count, undefined bond stereocenter count, covalently-bonded unit count, and compound is canonicalized.
Is (R)-Amino-cyclopropyl-acetic acid methyl ester a canonicalized compound?
Yes, (R)-Amino-cyclopropyl-acetic acid methyl ester is a canonicalized compound.