--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C4H10ClNO.
The molecular weight is 123.58 g/mol.
The IUPAC name is (2R)-2-aminobut-3-en-1-ol; hydrochloride.
The InChI is InChI=1S/C4H9NO.ClH/c1-2-4(5)3-6;/h2,4,6H,1,3,5H2;1H/t4-;/m1./s1.
The Canonical SMILES is C=CC(CO)N.Cl.
The Isomeric SMILES is C=C[C@H](CO)N.Cl.
The CAS number is 313995-40-3.
The Hydrogen Bond Donor Count is 3.
The Hydrogen Bond Acceptor Count is 2.
Yes, (R)-2-Amino-but-3-en-1-ol hydrochloride is a canonicalized compound.