What is the molecular formula of Pyridine-3-boronic acid HCL?
The molecular formula of Pyridine-3-boronic acid HCL is C5H7BClNO2.
What are the synonyms for Pyridine-3-boronic acid HCL?
The synonyms for Pyridine-3-boronic acid HCL are PYRIDINE-3-BORONIC ACID HYDROCHLORIDE, PYRIDINE-3-BORONIC ACID HCL, pyridin-3-ylboronic acid hydrochloride, and pyridin-3-ylboronic acid;hydrochloride.
What is the molecular weight of Pyridine-3-boronic acid HCL?
The molecular weight of Pyridine-3-boronic acid HCL is 159.38 g/mol.
What is the IUPAC name of Pyridine-3-boronic acid HCL?
The IUPAC name of Pyridine-3-boronic acid HCL is pyridin-3-ylboronic acid;hydrochloride.
What is the InChI of Pyridine-3-boronic acid HCL?
The InChI of Pyridine-3-boronic acid HCL is InChI=1S/C5H6BNO2.ClH/c8-6(9)5-2-1-3-7-4-5;/h1-4,8-9H;1H.
What is the InChIKey of Pyridine-3-boronic acid HCL?
The InChIKey of Pyridine-3-boronic acid HCL is QIXCETIHXIFXGF-UHFFFAOYSA-N.
What is the canonical SMILES of Pyridine-3-boronic acid HCL?
The canonical SMILES of Pyridine-3-boronic acid HCL is B(C1=CN=CC=C1)(O)O.Cl.
What is the CAS number of Pyridine-3-boronic acid HCL?
The CAS number of Pyridine-3-boronic acid HCL is 265664-63-9.
How many hydrogen bond donor counts does Pyridine-3-boronic acid HCL have?
Pyridine-3-boronic acid HCL has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Pyridine-3-boronic acid HCL have?
Pyridine-3-boronic acid HCL has 3 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.