What is the molecular formula of propyl salicylate?
The molecular formula of propyl salicylate is C10H12O3.
What is the molecular weight of propyl salicylate?
The molecular weight of propyl salicylate is 180.20 g/mol.
What is the IUPAC name of propyl salicylate?
The IUPAC name of propyl salicylate is propyl 2-hydroxybenzoate.
What is the InChI of propyl salicylate?
The InChI of propyl salicylate is InChI=1S/C10H12O3/c1-2-7-13-10(12)8-5-3-4-6-9(8)11/h3-6,11H,2,7H2,1H3.
What is the InChIKey of propyl salicylate?
The InChIKey of propyl salicylate is LZFIOSVZIQOVFW-UHFFFAOYSA-N.
What is the canonical SMILES of propyl salicylate?
The canonical SMILES of propyl salicylate is CCCOC(=O)C1=CC=CC=C1O.
What is the CAS number of propyl salicylate?
The CAS number of propyl salicylate is 607-90-9.
What is the European Community (EC) number of propyl salicylate?
The European Community (EC) number of propyl salicylate is 210-145-3.
What is the XLogP3 value of propyl salicylate?
The XLogP3 value of propyl salicylate is 3.8.
What is the hydrogen bond donor count of propyl salicylate?
The hydrogen bond donor count of propyl salicylate is 1.