30129-18-1 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of Propargyl-3-sulfopropyl ether sodium salt is C6H9NaO4S.
The molecular weight of Propargyl-3-sulfopropyl ether sodium salt is 200.19 g/mol.
The IUPAC name of Propargyl-3-sulfopropyl ether sodium salt is sodium;3-prop-2-ynoxypropane-1-sulfonate.
The InChI of Propargyl-3-sulfopropyl ether sodium salt is InChI=1S/C6H10O4S.Na/c1-2-4-10-5-3-6-11(7,8)9;/h1H,3-6H2,(H,7,8,9);/q;+1/p-1.
The Canonical SMILES of Propargyl-3-sulfopropyl ether sodium salt is C#CCOCCCS(=O)(=O)[O-].[Na+].
The CAS number for Propargyl-3-sulfopropyl ether sodium salt is 30290-53-0.
There are 4 hydrogen bond acceptors in Propargyl-3-sulfopropyl ether sodium salt.
The topological polar surface area of Propargyl-3-sulfopropyl ether sodium salt is 74.8 Ų.
There are 12 heavy atoms in Propargyl-3-sulfopropyl ether sodium salt.
Yes, the compound is canonicalized.
Download
×