What is the PubChem CID of Tripropylphosphine?
PubChem CID 75226.
What is the molecular formula of Tripropylphosphine?
The molecular formula is C9H21P.
What is the molecular weight of Tripropylphosphine?
The molecular weight is 160.24 g/mol.
What is the IUPAC name of Tripropylphosphine?
The IUPAC name is tripropylphosphane.
What is the InChI of Tripropylphosphine?
The InChI is InChI=1S/C9H21P/c1-4-7-10(8-5-2)9-6-3/h4-9H2,1-3H3.
What is the InChIKey of Tripropylphosphine?
The InChIKey is KCTAHLRCZMOTKM-UHFFFAOYSA-N.
What is the canonical SMILES of Tripropylphosphine?
The canonical SMILES is CCCP(CCC)CCC.
What is the CAS number of Tripropylphosphine?
The CAS number is 2234-97-1.
What is the EC number of Tripropylphosphine?
The EC number is 218-786-0.
Is Tripropylphosphine a canonicalized compound?
Yes, Tripropylphosphine is a canonicalized compound according to PubChem.