What is the molecular formula of Triphenylmethylsilane?
The molecular formula of Triphenylmethylsilane is C19H18Si.
What are the synonyms of Triphenylmethylsilane?
The synonyms of Triphenylmethylsilane include Methyltriphenylsilane, TRIPHENYLMETHYLSILANE, and Silane, methyltriphenyl-, among others.
What is the molecular weight of Triphenylmethylsilane?
The molecular weight of Triphenylmethylsilane is 274.4 g/mol.
What is the IUPAC name of Triphenylmethylsilane?
The IUPAC name of Triphenylmethylsilane is methyl(triphenyl)silane.
What is the InChI of Triphenylmethylsilane?
The InChI of Triphenylmethylsilane is InChI=1S/C19H18Si/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19/h2-16H,1H3.
What is the InChIKey of Triphenylmethylsilane?
The InChIKey of Triphenylmethylsilane is GIGVICQLYWGMGW-UHFFFAOYSA-N.
What is the Canonical SMILES of Triphenylmethylsilane?
The Canonical SMILES of Triphenylmethylsilane is C[Si](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.
What is the CAS number of Triphenylmethylsilane?
The CAS number of Triphenylmethylsilane is 791-29-7.
What is the hydrogen bond donor count of Triphenylmethylsilane?
Triphenylmethylsilane has a hydrogen bond donor count of 0.
Is Triphenylmethylsilane a canonicalized compound?
Yes, Triphenylmethylsilane is canonicalized according to PubChem.