Trimethylsilyl 2,2-difluoro-2-(fluorosulfonyl)acetate

• CAS: 120801-54-4
• Catalog Number: ACM120801544
• Category: Siloxanes
• Molecular Weight: 250.27
• Molecular Formula: C₅H₉F₃O₄SSi
• Appearance: Transparent liquid

Custom Q&A

What is the molecular formula of Trimethylsilyl 2,2-difluoro-2-(fluorosulfonyl)acetate?

The molecular formula is C5H9F3O4SSi.

What is the molecular weight of Trimethylsilyl 2,2-difluoro-2-(fluorosulfonyl)acetate?

The molecular weight is 250.27 g/mol.

What is the IUPAC name of Trimethylsilyl 2,2-difluoro-2-(fluorosulfonyl)acetate?

The IUPAC name is trimethylsilyl 2,2-difluoro-2-fluorosulfonylacetate.

What is the InChI of Trimethylsilyl 2,2-difluoro-2-(fluorosulfonyl)acetate?

The InChI is InChI=1S/C5H9F3O4SSi/c1-14(2,3)12-4(9)5(6,7)13(8,10)11/h1-3H3.

What is the InChIKey of Trimethylsilyl 2,2-difluoro-2-(fluorosulfonyl)acetate?

The InChIKey is XHVSCKNABCCCAC-UHFFFAOYSA-N.

What is the canonical SMILES of Trimethylsilyl 2,2-difluoro-2-(fluorosulfonyl)acetate?

The canonical SMILES is C[Si](C)(C)OC(=O)C(F)(F)S(=O)(=O)F.

What is the CAS number of Trimethylsilyl 2,2-difluoro-2-(fluorosulfonyl)acetate?

The CAS number is 120801-75-4.

What is the European Community (EC) number of Trimethylsilyl 2,2-difluoro-2-(fluorosulfonyl)acetate?

The European Community (EC) number is 670-657-1.

What is the DSSTox Substance ID of Trimethylsilyl 2,2-difluoro-2-(fluorosulfonyl)acetate?

The DSSTox Substance ID is DTXSID40380752.

Is Trimethylsilyl 2,2-difluoro-2-(fluorosulfonyl)acetate considered as a canonical compound?

Yes, it is considered as a canonical compound according to PubChem.